Xylitol
Specification: 98.5%
CAS No.: 87-99-0
Standard: FCC/USP/NF
Appearance: White crystal or crystalline powder.
Purity: 98.5%min,
Product name |
Xylitol |
Synonyms |
XYLIT; XYLITE; D-XYLITOL; 1,2,3,4,5-PENTAHYDROXYPENTANE |
Molecular Formula |
C 5 H 12 O 5 |
Molecular Weight |
152.15 |
InChI |
InChI=1/C5H12O5/c6-1-3(8)5(10)4(9)2-7/h3-10H,1-2H2/t3-,4+,5+ |
CAS Registry Number |
87-99-0;16277-71-7 |
EINECS |
201-788-0 |
Molecular Structure |
|
Melting point |
92-96°C |
Boiling point |
215~217°C |
Water solubility |
SOLUBLE |
1. Mannitol CP2005/BP/USP
2. Sorbitol CP2005/BP/USP
A. Powder
B. 70% non-crystalline
3. Xylitol
4. Maltitol
5. Erythritol
6. D-Xylose
Package: 25kg/drum or As your request.
Storage Situation: Stored in a cool and dry well-closed container. Keep away from moisture and strong light/heat.
Shelf Life: Two years when properly stored.
Delivery: Within two weeks after receiving your prepayment.
Service we can provide:
1. Mixed container, we can mix different items in one container.
2. Quality control, before shipment, free sample for test. After shipment, keep sample for 3 years
3. Prompt shipment with professional documents
4. Packing as your request, with photo before shipment.
*******************************************************************************
To get more information, just feel free to contact with us. Thanks.
Mr. Liu
Qingdao fraken international trading Co., Ltd
Address: RM1005 post mansion yan'an three road, qingdao, China
Tel: 0086 532 83899718
Fax: 0086 532 83623236
Web: http://fraken.en.made-in-china.com/